C22H25NO6S — CID 126843273
(5S,8S,9R)-8-benzoyl-9-hydroxy-8-methoxy-3-methyl-2-[(E,4S)-4-sulfanylhex-1-enyl]-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione (PubChem CID 126843273) has the molecular formula C22H25NO6S and a molecular weight of 431.51 g/mol. Its IUPAC name is (5S,8S,9R)-8-benzoyl-9-hydroxy-8-methoxy-3-methyl-2-[(E,4S)-4-sulfanylhex-1-enyl]-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione.
| Compound Name | (5S,8S,9R)-8-benzoyl-9-hydroxy-8-methoxy-3-methyl-2-[(E,4S)-4-sulfanylhex-1-enyl]-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
|---|---|
| PubChem CID | 126843273 |
| Molecular Formula | C22H25NO6S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (5S,8S,9R)-8-benzoyl-9-hydroxy-8-methoxy-3-methyl-2-[(E,4S)-4-sulfanylhex-1-enyl]-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
| SMILES | CC[C@H](S)C/C=C/C1=C(C)C(=O)[C@]2(O1)C(=O)N[C@@](OC)(C(=O)c1ccccc1)[C@@H]2O |
| InChI | InChI=1S/C22H25NO6S/c1-4-15(30)11-8-12-16-13(2)17(24)21(29-16)19(26)22(28-3,23-20(21)27)18(25)14-9-6-5-7-10-14/h5-10,12,15,19,26,30H,4,11H2,1-3H3,(H,23,27)/b12-8+/t15-,19+,21+,22+/m0/s1 |
| InChIKey | NFXSKRFQPAQUMM-FXTNJNAMSA-N |
| XLogP | 1.97 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|