C6H13KNO10P2Zn+3 — CID 126843280
potassium;zinc;2-[carboxymethyl(1,1-diphosphonoethyl)amino]acetic acid (PubChem CID 126843280) has the molecular formula C6H13KNO10P2Zn+3 and a molecular weight of 425.60 g/mol. Its IUPAC name is potassium;zinc;2-[carboxymethyl(1,1-diphosphonoethyl)amino]acetic acid.
| Compound Name | potassium;zinc;2-[carboxymethyl(1,1-diphosphonoethyl)amino]acetic acid |
|---|---|
| PubChem CID | 126843280 |
| Molecular Formula | C6H13KNO10P2Zn+3 |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 423.89 |
| IUPAC Name | potassium;zinc;2-[carboxymethyl(1,1-diphosphonoethyl)amino]acetic acid |
| SMILES | CC(N(CC(=O)O)CC(=O)O)(P(=O)(O)O)P(=O)(O)O.[K+].[Zn+2] |
| InChI | InChI=1S/C6H13NO10P2.K.Zn/c1-6(18(12,13)14,19(15,16)17)7(2-4(8)9)3-5(10)11;;/h2-3H2,1H3,(H,8,9)(H,10,11)(H2,12,13,14)(H2,15,16,17);;/q;+1;+2 |
| InChIKey | QTBDNNIXXOKETI-UHFFFAOYSA-N |
| XLogP | -4.51 |
| TPSA | 192.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | -4.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|