C23H17F3N2O — CID 126843825
1-(5-benzyl-7-methyl-5,6-diazatetracyclo[6.5.2.04,15.011,14]pentadeca-1,3,6,8(15),9,11(14)-hexaen-3-yl)-2,2,2-trifluoroethanone (PubChem CID 126843825) has the molecular formula C23H17F3N2O and a molecular weight of 394.40 g/mol. Its IUPAC name is 1-(5-benzyl-7-methyl-5,6-diazatetracyclo[6.5.2.04,15.011,14]pentadeca-1,3,6,8(15),9,11(14)-hexaen-3-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(5-benzyl-7-methyl-5,6-diazatetracyclo[6.5.2.04,15.011,14]pentadeca-1,3,6,8(15),9,11(14)-hexaen-3-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 126843825 |
| Molecular Formula | C23H17F3N2O |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 1-(5-benzyl-7-methyl-5,6-diazatetracyclo[6.5.2.04,15.011,14]pentadeca-1,3,6,8(15),9,11(14)-hexaen-3-yl)-2,2,2-trifluoroethanone |
| SMILES | CC1=NN(Cc2ccccc2)c2c(C(=O)C(F)(F)F)cc3c4c(ccc1c24)CC3 |
| InChI | InChI=1S/C23H17F3N2O/c1-13-17-10-9-15-7-8-16-11-18(22(29)23(24,25)26)21(20(17)19(15)16)28(27-13)12-14-5-3-2-4-6-14/h2-6,9-11H,7-8,12H2,1H3 |
| InChIKey | OPAMFCJTDVSYKC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |