About 8,8-difluoro-1-azaspiro[4.5]decane;hydrochloride
8,8-difluoro-1-azaspiro[4.5]decane;hydrochloride (PubChem CID 126843941) has the molecular formula C9H16ClF2N
and a molecular weight of 211.68 g/mol. Its IUPAC name is 8,8-difluoro-1-azaspiro[4.5]decane;hydrochloride.
Molecular Properties
| Compound Name | 8,8-difluoro-1-azaspiro[4.5]decane;hydrochloride |
| PubChem CID | 126843941 |
| Molecular Formula | C9H16ClF2N |
| Molecular Weight | 211.68 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 8,8-difluoro-1-azaspiro[4.5]decane;hydrochloride |
| SMILES | Cl.FC1(F)CCC2(CCCN2)CC1 |
| InChI | InChI=1S/C9H15F2N.ClH/c10-9(11)5-3-8(4-6-9)2-1-7-12-8;/h12H,1-7H2;1H |
| InChIKey | GHVXUPUPTDACGN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.68 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8,8-difluoro-1-azaspiro[4.5]decane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-difluoro-1-azaspiro[4.5]decane;hydrochloride?
The IUPAC name of 8,8-difluoro-1-azaspiro[4.5]decane;hydrochloride (CID 126843941) is 8,8-difluoro-1-azaspiro[4.5]decane;hydrochloride.
What is the SMILES notation for 8,8-difluoro-1-azaspiro[4.5]decane;hydrochloride?
The canonical SMILES for 8,8-difluoro-1-azaspiro[4.5]decane;hydrochloride is Cl.FC1(F)CCC2(CCCN2)CC1.
What is the InChIKey of 8,8-difluoro-1-azaspiro[4.5]decane;hydrochloride?
The InChIKey is GHVXUPUPTDACGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2N.ClH/c10-9(11)5-3-8(4-6-9)2-1-7-12-8;/h12H,1-7H2;1H.
What are the key properties of 8,8-difluoro-1-azaspiro[4.5]decane;hydrochloride?
8,8-difluoro-1-azaspiro[4.5]decane;hydrochloride has a molecular weight of 211.68 g/mol, XLogP of 2.74, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-difluoro-1-azaspiro[4.5]decane;hydrochloride is sourced from PubChem (CID 126843941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).