About 3-(5-tert-butyl-1,2-oxazol-3-yl)propan-1-amine;hydrochloride
3-(5-tert-butyl-1,2-oxazol-3-yl)propan-1-amine;hydrochloride (PubChem CID 126843999) has the molecular formula C10H19ClN2O
and a molecular weight of 218.73 g/mol. Its IUPAC name is 3-(5-tert-butyl-1,2-oxazol-3-yl)propan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-(5-tert-butyl-1,2-oxazol-3-yl)propan-1-amine;hydrochloride |
| PubChem CID | 126843999 |
| Molecular Formula | C10H19ClN2O |
| Molecular Weight | 218.73 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 3-(5-tert-butyl-1,2-oxazol-3-yl)propan-1-amine;hydrochloride |
| SMILES | CC(C)(C)c1cc(CCCN)no1.Cl |
| InChI | InChI=1S/C10H18N2O.ClH/c1-10(2,3)9-7-8(12-13-9)5-4-6-11;/h7H,4-6,11H2,1-3H3;1H |
| InChIKey | OSZNYTLWMNQROQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.73 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-tert-butyl-1,2-oxazol-3-yl)propan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-tert-butyl-1,2-oxazol-3-yl)propan-1-amine;hydrochloride?
The IUPAC name of 3-(5-tert-butyl-1,2-oxazol-3-yl)propan-1-amine;hydrochloride (CID 126843999) is 3-(5-tert-butyl-1,2-oxazol-3-yl)propan-1-amine;hydrochloride.
What is the SMILES notation for 3-(5-tert-butyl-1,2-oxazol-3-yl)propan-1-amine;hydrochloride?
The canonical SMILES for 3-(5-tert-butyl-1,2-oxazol-3-yl)propan-1-amine;hydrochloride is CC(C)(C)c1cc(CCCN)no1.Cl.
What is the InChIKey of 3-(5-tert-butyl-1,2-oxazol-3-yl)propan-1-amine;hydrochloride?
The InChIKey is OSZNYTLWMNQROQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O.ClH/c1-10(2,3)9-7-8(12-13-9)5-4-6-11;/h7H,4-6,11H2,1-3H3;1H.
What are the key properties of 3-(5-tert-butyl-1,2-oxazol-3-yl)propan-1-amine;hydrochloride?
3-(5-tert-butyl-1,2-oxazol-3-yl)propan-1-amine;hydrochloride has a molecular weight of 218.73 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-tert-butyl-1,2-oxazol-3-yl)propan-1-amine;hydrochloride is sourced from PubChem (CID 126843999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).