C10H20Cl2F2N2 — CID 126844182
(3S,8aS)-7,7-difluoro-3-propan-2-yl-2,3,4,6,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;dihydrochloride (PubChem CID 126844182) has the molecular formula C10H20Cl2F2N2 and a molecular weight of 277.19 g/mol. Its IUPAC name is (3S,8aS)-7,7-difluoro-3-propan-2-yl-2,3,4,6,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;dihydrochloride.
| Compound Name | (3S,8aS)-7,7-difluoro-3-propan-2-yl-2,3,4,6,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;dihydrochloride |
|---|---|
| PubChem CID | 126844182 |
| Molecular Formula | C10H20Cl2F2N2 |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (3S,8aS)-7,7-difluoro-3-propan-2-yl-2,3,4,6,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;dihydrochloride |
| SMILES | CC(C)[C@H]1CN2CC(F)(F)C[C@H]2CN1.Cl.Cl |
| InChI | InChI=1S/C10H18F2N2.2ClH/c1-7(2)9-5-14-6-10(11,12)3-8(14)4-13-9;;/h7-9,13H,3-6H2,1-2H3;2*1H/t8-,9+;;/m0../s1 |
| InChIKey | KVYHUQYJNRRSSP-DBEJOZALSA-N |
| XLogP | 2.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |