About 7-methoxyspiro[3H-1-benzofuran-2,3'-azetidine];hydrochloride
7-methoxyspiro[3H-1-benzofuran-2,3'-azetidine];hydrochloride (PubChem CID 126844423) has the molecular formula C11H14ClNO2
and a molecular weight of 227.69 g/mol. Its IUPAC name is 7-methoxyspiro[3H-1-benzofuran-2,3'-azetidine];hydrochloride.
Molecular Properties
| Compound Name | 7-methoxyspiro[3H-1-benzofuran-2,3'-azetidine];hydrochloride |
| PubChem CID | 126844423 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 7-methoxyspiro[3H-1-benzofuran-2,3'-azetidine];hydrochloride |
| SMILES | COc1cccc2c1OC1(CNC1)C2.Cl |
| InChI | InChI=1S/C11H13NO2.ClH/c1-13-9-4-2-3-8-5-11(6-12-7-11)14-10(8)9;/h2-4,12H,5-7H2,1H3;1H |
| InChIKey | XAMISWXSQCEMSL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxyspiro[3H-1-benzofuran-2,3'-azetidine];hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxyspiro[3H-1-benzofuran-2,3'-azetidine];hydrochloride?
The IUPAC name of 7-methoxyspiro[3H-1-benzofuran-2,3'-azetidine];hydrochloride (CID 126844423) is 7-methoxyspiro[3H-1-benzofuran-2,3'-azetidine];hydrochloride.
What is the SMILES notation for 7-methoxyspiro[3H-1-benzofuran-2,3'-azetidine];hydrochloride?
The canonical SMILES for 7-methoxyspiro[3H-1-benzofuran-2,3'-azetidine];hydrochloride is COc1cccc2c1OC1(CNC1)C2.Cl.
What is the InChIKey of 7-methoxyspiro[3H-1-benzofuran-2,3'-azetidine];hydrochloride?
The InChIKey is XAMISWXSQCEMSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2.ClH/c1-13-9-4-2-3-8-5-11(6-12-7-11)14-10(8)9;/h2-4,12H,5-7H2,1H3;1H.
What are the key properties of 7-methoxyspiro[3H-1-benzofuran-2,3'-azetidine];hydrochloride?
7-methoxyspiro[3H-1-benzofuran-2,3'-azetidine];hydrochloride has a molecular weight of 227.69 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxyspiro[3H-1-benzofuran-2,3'-azetidine];hydrochloride is sourced from PubChem (CID 126844423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).