About 3-nitropropan-1-amine;hydrochloride
3-nitropropan-1-amine;hydrochloride (PubChem CID 126844432) has the molecular formula C3H9ClN2O2
and a molecular weight of 140.57 g/mol. Its IUPAC name is 3-nitropropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-nitropropan-1-amine;hydrochloride |
| PubChem CID | 126844432 |
| Molecular Formula | C3H9ClN2O2 |
| Molecular Weight | 140.57 g/mol |
| Exact Mass | 140.04 |
| IUPAC Name | 3-nitropropan-1-amine;hydrochloride |
| SMILES | Cl.NCCC[N+](=O)[O-] |
| InChI | InChI=1S/C3H8N2O2.ClH/c4-2-1-3-5(6)7;/h1-4H2;1H |
| InChIKey | NQTWZKQZDKWUBT-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.57 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitropropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitropropan-1-amine;hydrochloride?
The IUPAC name of 3-nitropropan-1-amine;hydrochloride (CID 126844432) is 3-nitropropan-1-amine;hydrochloride.
What is the SMILES notation for 3-nitropropan-1-amine;hydrochloride?
The canonical SMILES for 3-nitropropan-1-amine;hydrochloride is Cl.NCCC[N+](=O)[O-].
What is the InChIKey of 3-nitropropan-1-amine;hydrochloride?
The InChIKey is NQTWZKQZDKWUBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2O2.ClH/c4-2-1-3-5(6)7;/h1-4H2;1H.
What are the key properties of 3-nitropropan-1-amine;hydrochloride?
3-nitropropan-1-amine;hydrochloride has a molecular weight of 140.57 g/mol, XLogP of 0.03, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitropropan-1-amine;hydrochloride is sourced from PubChem (CID 126844432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).