About 2-[(E)-2-(3,5-difluorophenyl)ethenyl]pyrrolidine;hydrochloride
2-[(E)-2-(3,5-difluorophenyl)ethenyl]pyrrolidine;hydrochloride (PubChem CID 126844673) has the molecular formula C12H14ClF2N
and a molecular weight of 245.70 g/mol. Its IUPAC name is 2-[(E)-2-(3,5-difluorophenyl)ethenyl]pyrrolidine;hydrochloride.
Molecular Properties
| Compound Name | 2-[(E)-2-(3,5-difluorophenyl)ethenyl]pyrrolidine;hydrochloride |
| PubChem CID | 126844673 |
| Molecular Formula | C12H14ClF2N |
| Molecular Weight | 245.70 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 2-[(E)-2-(3,5-difluorophenyl)ethenyl]pyrrolidine;hydrochloride |
| SMILES | Cl.Fc1cc(F)cc(/C=C/C2CCCN2)c1 |
| InChI | InChI=1S/C12H13F2N.ClH/c13-10-6-9(7-11(14)8-10)3-4-12-2-1-5-15-12;/h3-4,6-8,12,15H,1-2,5H2;1H/b4-3+; |
| InChIKey | YSCLKZOKQGWUCB-BJILWQEISA-N |
| XLogP | 3.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.70 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(E)-2-(3,5-difluorophenyl)ethenyl]pyrrolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(3,5-difluorophenyl)ethenyl]pyrrolidine;hydrochloride?
The IUPAC name of 2-[(E)-2-(3,5-difluorophenyl)ethenyl]pyrrolidine;hydrochloride (CID 126844673) is 2-[(E)-2-(3,5-difluorophenyl)ethenyl]pyrrolidine;hydrochloride.
What is the SMILES notation for 2-[(E)-2-(3,5-difluorophenyl)ethenyl]pyrrolidine;hydrochloride?
The canonical SMILES for 2-[(E)-2-(3,5-difluorophenyl)ethenyl]pyrrolidine;hydrochloride is Cl.Fc1cc(F)cc(/C=C/C2CCCN2)c1.
What is the InChIKey of 2-[(E)-2-(3,5-difluorophenyl)ethenyl]pyrrolidine;hydrochloride?
The InChIKey is YSCLKZOKQGWUCB-BJILWQEISA-N. The full InChI is InChI=1S/C12H13F2N.ClH/c13-10-6-9(7-11(14)8-10)3-4-12-2-1-5-15-12;/h3-4,6-8,12,15H,1-2,5H2;1H/b4-3+;.
What are the key properties of 2-[(E)-2-(3,5-difluorophenyl)ethenyl]pyrrolidine;hydrochloride?
2-[(E)-2-(3,5-difluorophenyl)ethenyl]pyrrolidine;hydrochloride has a molecular weight of 245.70 g/mol, XLogP of 3.15, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(3,5-difluorophenyl)ethenyl]pyrrolidine;hydrochloride is sourced from PubChem (CID 126844673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).