About N-[2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]ethyl]propan-2-amine
N-[2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]ethyl]propan-2-amine (PubChem CID 126845170) has the molecular formula C11H21F2NO
and a molecular weight of 221.29 g/mol. Its IUPAC name is N-[2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]ethyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]ethyl]propan-2-amine |
| PubChem CID | 126845170 |
| Molecular Formula | C11H21F2NO |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | N-[2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]ethyl]propan-2-amine |
| SMILES | CC(C)NCCOCC1C(C)(C)C1(F)F |
| InChI | InChI=1S/C11H21F2NO/c1-8(2)14-5-6-15-7-9-10(3,4)11(9,12)13/h8-9,14H,5-7H2,1-4H3 |
| InChIKey | JMBOOUOEWXFRJL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]ethyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]ethyl]propan-2-amine?
The IUPAC name of N-[2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]ethyl]propan-2-amine (CID 126845170) is N-[2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]ethyl]propan-2-amine.
What is the SMILES notation for N-[2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]ethyl]propan-2-amine?
The canonical SMILES for N-[2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]ethyl]propan-2-amine is CC(C)NCCOCC1C(C)(C)C1(F)F.
What is the InChIKey of N-[2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]ethyl]propan-2-amine?
The InChIKey is JMBOOUOEWXFRJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F2NO/c1-8(2)14-5-6-15-7-9-10(3,4)11(9,12)13/h8-9,14H,5-7H2,1-4H3.
What are the key properties of N-[2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]ethyl]propan-2-amine?
N-[2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]ethyl]propan-2-amine has a molecular weight of 221.29 g/mol, XLogP of 2.29, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]ethyl]propan-2-amine is sourced from PubChem (CID 126845170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).