C10H22N2O2 — CID 126846675
(3S,4R)-4-[2-(diethylamino)ethylamino]oxolan-3-ol (PubChem CID 126846675) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (3S,4R)-4-[2-(diethylamino)ethylamino]oxolan-3-ol.
| Compound Name | (3S,4R)-4-[2-(diethylamino)ethylamino]oxolan-3-ol |
|---|---|
| PubChem CID | 126846675 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | (3S,4R)-4-[2-(diethylamino)ethylamino]oxolan-3-ol |
| SMILES | CCN(CC)CCN[C@@H]1COC[C@H]1O |
| InChI | InChI=1S/C10H22N2O2/c1-3-12(4-2)6-5-11-9-7-14-8-10(9)13/h9-11,13H,3-8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | PATIPMVUUZPUTB-NXEZZACHSA-N |
| XLogP | -0.32 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |