About N'-ethylethanedithioamide
N'-ethylethanedithioamide (PubChem CID 12684682) has the molecular formula C4H8N2S2
and a molecular weight of 148.26 g/mol. Its IUPAC name is N'-ethylethanedithioamide.
Molecular Properties
| Compound Name | N'-ethylethanedithioamide |
| PubChem CID | 12684682 |
| Molecular Formula | C4H8N2S2 |
| Molecular Weight | 148.26 g/mol |
| Exact Mass | 148.01 |
| IUPAC Name | N'-ethylethanedithioamide |
| SMILES | CCNC(=S)C(N)=S |
| InChI | InChI=1S/C4H8N2S2/c1-2-6-4(8)3(5)7/h2H2,1H3,(H2,5,7)(H,6,8) |
| InChIKey | TUTOQTNIHPIGRN-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N'-ethylethanedithioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethylethanedithioamide?
The IUPAC name of N'-ethylethanedithioamide (CID 12684682) is N'-ethylethanedithioamide.
What is the SMILES notation for N'-ethylethanedithioamide?
The canonical SMILES for N'-ethylethanedithioamide is CCNC(=S)C(N)=S.
What is the InChIKey of N'-ethylethanedithioamide?
The InChIKey is TUTOQTNIHPIGRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2S2/c1-2-6-4(8)3(5)7/h2H2,1H3,(H2,5,7)(H,6,8).
What are the key properties of N'-ethylethanedithioamide?
N'-ethylethanedithioamide has a molecular weight of 148.26 g/mol, XLogP of 0.21, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethylethanedithioamide is sourced from PubChem (CID 12684682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).