About 5-methyl-1-prop-2-ynyl-6,7-dihydro-4H-triazolo[4,5-c]pyridine
5-methyl-1-prop-2-ynyl-6,7-dihydro-4H-triazolo[4,5-c]pyridine (PubChem CID 126847421) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is 5-methyl-1-prop-2-ynyl-6,7-dihydro-4H-triazolo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 5-methyl-1-prop-2-ynyl-6,7-dihydro-4H-triazolo[4,5-c]pyridine |
| PubChem CID | 126847421 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 5-methyl-1-prop-2-ynyl-6,7-dihydro-4H-triazolo[4,5-c]pyridine |
| SMILES | C#CCn1nnc2c1CCN(C)C2 |
| InChI | InChI=1S/C9H12N4/c1-3-5-13-9-4-6-12(2)7-8(9)10-11-13/h1H,4-7H2,2H3 |
| InChIKey | NCFJPNSAVMOWNB-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-1-prop-2-ynyl-6,7-dihydro-4H-triazolo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-prop-2-ynyl-6,7-dihydro-4H-triazolo[4,5-c]pyridine?
The IUPAC name of 5-methyl-1-prop-2-ynyl-6,7-dihydro-4H-triazolo[4,5-c]pyridine (CID 126847421) is 5-methyl-1-prop-2-ynyl-6,7-dihydro-4H-triazolo[4,5-c]pyridine.
What is the SMILES notation for 5-methyl-1-prop-2-ynyl-6,7-dihydro-4H-triazolo[4,5-c]pyridine?
The canonical SMILES for 5-methyl-1-prop-2-ynyl-6,7-dihydro-4H-triazolo[4,5-c]pyridine is C#CCn1nnc2c1CCN(C)C2.
What is the InChIKey of 5-methyl-1-prop-2-ynyl-6,7-dihydro-4H-triazolo[4,5-c]pyridine?
The InChIKey is NCFJPNSAVMOWNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c1-3-5-13-9-4-6-12(2)7-8(9)10-11-13/h1H,4-7H2,2H3.
What are the key properties of 5-methyl-1-prop-2-ynyl-6,7-dihydro-4H-triazolo[4,5-c]pyridine?
5-methyl-1-prop-2-ynyl-6,7-dihydro-4H-triazolo[4,5-c]pyridine has a molecular weight of 176.22 g/mol, XLogP of -0.10, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-prop-2-ynyl-6,7-dihydro-4H-triazolo[4,5-c]pyridine is sourced from PubChem (CID 126847421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).