About (3S,4S)-1,1-dioxo-4-(2-thiophen-2-ylethynyl)thiolan-3-ol
(3S,4S)-1,1-dioxo-4-(2-thiophen-2-ylethynyl)thiolan-3-ol (PubChem CID 126847525) has the molecular formula C10H10O3S2
and a molecular weight of 242.32 g/mol. Its IUPAC name is (3S,4S)-1,1-dioxo-4-(2-thiophen-2-ylethynyl)thiolan-3-ol.
Molecular Properties
| Compound Name | (3S,4S)-1,1-dioxo-4-(2-thiophen-2-ylethynyl)thiolan-3-ol |
| PubChem CID | 126847525 |
| Molecular Formula | C10H10O3S2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | (3S,4S)-1,1-dioxo-4-(2-thiophen-2-ylethynyl)thiolan-3-ol |
| SMILES | O=S1(=O)C[C@@H](O)[C@H](C#Cc2cccs2)C1 |
| InChI | InChI=1S/C10H10O3S2/c11-10-7-15(12,13)6-8(10)3-4-9-2-1-5-14-9/h1-2,5,8,10-11H,6-7H2/t8-,10-/m1/s1 |
| InChIKey | LPGBUOKEFWHNHJ-PSASIEDQSA-N |
| XLogP | 0.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-1,1-dioxo-4-(2-thiophen-2-ylethynyl)thiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-1,1-dioxo-4-(2-thiophen-2-ylethynyl)thiolan-3-ol?
The IUPAC name of (3S,4S)-1,1-dioxo-4-(2-thiophen-2-ylethynyl)thiolan-3-ol (CID 126847525) is (3S,4S)-1,1-dioxo-4-(2-thiophen-2-ylethynyl)thiolan-3-ol.
What is the SMILES notation for (3S,4S)-1,1-dioxo-4-(2-thiophen-2-ylethynyl)thiolan-3-ol?
The canonical SMILES for (3S,4S)-1,1-dioxo-4-(2-thiophen-2-ylethynyl)thiolan-3-ol is O=S1(=O)C[C@@H](O)[C@H](C#Cc2cccs2)C1.
What is the InChIKey of (3S,4S)-1,1-dioxo-4-(2-thiophen-2-ylethynyl)thiolan-3-ol?
The InChIKey is LPGBUOKEFWHNHJ-PSASIEDQSA-N. The full InChI is InChI=1S/C10H10O3S2/c11-10-7-15(12,13)6-8(10)3-4-9-2-1-5-14-9/h1-2,5,8,10-11H,6-7H2/t8-,10-/m1/s1.
What are the key properties of (3S,4S)-1,1-dioxo-4-(2-thiophen-2-ylethynyl)thiolan-3-ol?
(3S,4S)-1,1-dioxo-4-(2-thiophen-2-ylethynyl)thiolan-3-ol has a molecular weight of 242.32 g/mol, XLogP of 0.51, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-1,1-dioxo-4-(2-thiophen-2-ylethynyl)thiolan-3-ol is sourced from PubChem (CID 126847525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).