About (3R,4R)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidin-3-ol
(3R,4R)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidin-3-ol (PubChem CID 126847733) has the molecular formula C10H15N3OS
and a molecular weight of 225.32 g/mol. Its IUPAC name is (3R,4R)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidin-3-ol.
Molecular Properties
| Compound Name | (3R,4R)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidin-3-ol |
| PubChem CID | 126847733 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | (3R,4R)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidin-3-ol |
| SMILES | Cc1cc(C)nc(S[C@@H]2CNC[C@H]2O)n1 |
| InChI | InChI=1S/C10H15N3OS/c1-6-3-7(2)13-10(12-6)15-9-5-11-4-8(9)14/h3,8-9,11,14H,4-5H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | MPXFNUZVRUJDMS-RKDXNWHRSA-N |
| XLogP | 0.52 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R,4R)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidin-3-ol?
The IUPAC name of (3R,4R)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidin-3-ol (CID 126847733) is (3R,4R)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidin-3-ol.
What is the SMILES notation for (3R,4R)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidin-3-ol?
The canonical SMILES for (3R,4R)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidin-3-ol is Cc1cc(C)nc(S[C@@H]2CNC[C@H]2O)n1.
What is the InChIKey of (3R,4R)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidin-3-ol?
The InChIKey is MPXFNUZVRUJDMS-RKDXNWHRSA-N. The full InChI is InChI=1S/C10H15N3OS/c1-6-3-7(2)13-10(12-6)15-9-5-11-4-8(9)14/h3,8-9,11,14H,4-5H2,1-2H3/t8-,9-/m1/s1.
What are the key properties of (3R,4R)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidin-3-ol?
(3R,4R)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidin-3-ol has a molecular weight of 225.32 g/mol, XLogP of 0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidin-3-ol is sourced from PubChem (CID 126847733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).