C8H16FNO — CID 126847893
(3R,4S)-4-fluoro-N-(2-methylpropyl)oxolan-3-amine (PubChem CID 126847893) has the molecular formula C8H16FNO and a molecular weight of 161.22 g/mol. Its IUPAC name is (3R,4S)-4-fluoro-N-(2-methylpropyl)oxolan-3-amine.
| Compound Name | (3R,4S)-4-fluoro-N-(2-methylpropyl)oxolan-3-amine |
|---|---|
| PubChem CID | 126847893 |
| Molecular Formula | C8H16FNO |
| Molecular Weight | 161.22 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (3R,4S)-4-fluoro-N-(2-methylpropyl)oxolan-3-amine |
| SMILES | CC(C)CN[C@@H]1COC[C@H]1F |
| InChI | InChI=1S/C8H16FNO/c1-6(2)3-10-8-5-11-4-7(8)9/h6-8,10H,3-5H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | UNCBZVQUKXQDGK-HTQZYQBOSA-N |
| XLogP | 0.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |