About 2-ethyl-1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole
2-ethyl-1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole (PubChem CID 126847905) has the molecular formula C9H13FN2O
and a molecular weight of 184.21 g/mol. Its IUPAC name is 2-ethyl-1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole.
Molecular Properties
| Compound Name | 2-ethyl-1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole |
| PubChem CID | 126847905 |
| Molecular Formula | C9H13FN2O |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-ethyl-1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole |
| SMILES | CCc1nccn1[C@@H]1COC[C@H]1F |
| InChI | InChI=1S/C9H13FN2O/c1-2-9-11-3-4-12(9)8-6-13-5-7(8)10/h3-4,7-8H,2,5-6H2,1H3/t7-,8-/m1/s1 |
| InChIKey | LQSIWNZIMVAUHF-HTQZYQBOSA-N |
| XLogP | 1.35 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole?
The IUPAC name of 2-ethyl-1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole (CID 126847905) is 2-ethyl-1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole.
What is the SMILES notation for 2-ethyl-1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole?
The canonical SMILES for 2-ethyl-1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole is CCc1nccn1[C@@H]1COC[C@H]1F.
What is the InChIKey of 2-ethyl-1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole?
The InChIKey is LQSIWNZIMVAUHF-HTQZYQBOSA-N. The full InChI is InChI=1S/C9H13FN2O/c1-2-9-11-3-4-12(9)8-6-13-5-7(8)10/h3-4,7-8H,2,5-6H2,1H3/t7-,8-/m1/s1.
What are the key properties of 2-ethyl-1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole?
2-ethyl-1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole has a molecular weight of 184.21 g/mol, XLogP of 1.35, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole is sourced from PubChem (CID 126847905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).