About 1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole
1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole (PubChem CID 126847907) has the molecular formula C7H9FN2O
and a molecular weight of 156.16 g/mol. Its IUPAC name is 1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole.
Molecular Properties
| Compound Name | 1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole |
| PubChem CID | 126847907 |
| Molecular Formula | C7H9FN2O |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole |
| SMILES | F[C@@H]1COC[C@H]1n1ccnc1 |
| InChI | InChI=1S/C7H9FN2O/c8-6-3-11-4-7(6)10-2-1-9-5-10/h1-2,5-7H,3-4H2/t6-,7-/m1/s1 |
| InChIKey | ZSKZXUXXERAQDE-RNFRBKRXSA-N |
| XLogP | 0.79 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole?
The IUPAC name of 1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole (CID 126847907) is 1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole.
What is the SMILES notation for 1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole?
The canonical SMILES for 1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole is F[C@@H]1COC[C@H]1n1ccnc1.
What is the InChIKey of 1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole?
The InChIKey is ZSKZXUXXERAQDE-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H9FN2O/c8-6-3-11-4-7(6)10-2-1-9-5-10/h1-2,5-7H,3-4H2/t6-,7-/m1/s1.
What are the key properties of 1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole?
1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole has a molecular weight of 156.16 g/mol, XLogP of 0.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R,4S)-4-fluorooxolan-3-yl]imidazole is sourced from PubChem (CID 126847907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).