C10H13N3O2 — CID 126848131
2-[(6-cyclobutylpyrimidin-4-yl)amino]acetic acid (PubChem CID 126848131) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-[(6-cyclobutylpyrimidin-4-yl)amino]acetic acid.
| Compound Name | 2-[(6-cyclobutylpyrimidin-4-yl)amino]acetic acid |
|---|---|
| PubChem CID | 126848131 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2-[(6-cyclobutylpyrimidin-4-yl)amino]acetic acid |
| SMILES | O=C(O)CNc1cc(C2CCC2)ncn1 |
| InChI | InChI=1S/C10H13N3O2/c14-10(15)5-11-9-4-8(12-6-13-9)7-2-1-3-7/h4,6-7H,1-3,5H2,(H,14,15)(H,11,12,13) |
| InChIKey | KTBYPQQUMZAZIT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |