C14H23N3O3 — CID 126848753
N-(2,2-diethoxyethyl)-6-(oxolan-3-yl)pyrimidin-4-amine (PubChem CID 126848753) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-6-(oxolan-3-yl)pyrimidin-4-amine.
| Compound Name | N-(2,2-diethoxyethyl)-6-(oxolan-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 126848753 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | N-(2,2-diethoxyethyl)-6-(oxolan-3-yl)pyrimidin-4-amine |
| SMILES | CCOC(CNc1cc(C2CCOC2)ncn1)OCC |
| InChI | InChI=1S/C14H23N3O3/c1-3-19-14(20-4-2)8-15-13-7-12(16-10-17-13)11-5-6-18-9-11/h7,10-11,14H,3-6,8-9H2,1-2H3,(H,15,16,17) |
| InChIKey | WONPJUMRDVXENZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|