C10H12F3N3O — CID 126848845
6-(oxolan-2-yl)-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine (PubChem CID 126848845) has the molecular formula C10H12F3N3O and a molecular weight of 247.22 g/mol. Its IUPAC name is 6-(oxolan-2-yl)-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine.
| Compound Name | 6-(oxolan-2-yl)-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 126848845 |
| Molecular Formula | C10H12F3N3O |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 6-(oxolan-2-yl)-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)CNc1cc(C2CCCO2)ncn1 |
| InChI | InChI=1S/C10H12F3N3O/c11-10(12,13)5-14-9-4-7(15-6-16-9)8-2-1-3-17-8/h4,6,8H,1-3,5H2,(H,14,15,16) |
| InChIKey | PYKUFHIJJPADFH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |