C9H12FN3 — CID 126849132
N-(cyclopropylmethyl)-6-(fluoromethyl)pyrimidin-4-amine (PubChem CID 126849132) has the molecular formula C9H12FN3 and a molecular weight of 181.21 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-6-(fluoromethyl)pyrimidin-4-amine.
| Compound Name | N-(cyclopropylmethyl)-6-(fluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 126849132 |
| Molecular Formula | C9H12FN3 |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | N-(cyclopropylmethyl)-6-(fluoromethyl)pyrimidin-4-amine |
| SMILES | FCc1cc(NCC2CC2)ncn1 |
| InChI | InChI=1S/C9H12FN3/c10-4-8-3-9(13-6-12-8)11-5-7-1-2-7/h3,6-7H,1-2,4-5H2,(H,11,12,13) |
| InChIKey | GNUCULZPWQXNFY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |