C17H26N4O3 — CID 126849898
tert-butyl N-methyl-N-[1-[6-(oxolan-2-yl)pyrimidin-4-yl]azetidin-3-yl]carbamate (PubChem CID 126849898) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[1-[6-(oxolan-2-yl)pyrimidin-4-yl]azetidin-3-yl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[1-[6-(oxolan-2-yl)pyrimidin-4-yl]azetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 126849898 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | tert-butyl N-methyl-N-[1-[6-(oxolan-2-yl)pyrimidin-4-yl]azetidin-3-yl]carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CN(c2cc(C3CCCO3)ncn2)C1 |
| InChI | InChI=1S/C17H26N4O3/c1-17(2,3)24-16(22)20(4)12-9-21(10-12)15-8-13(18-11-19-15)14-6-5-7-23-14/h8,11-12,14H,5-7,9-10H2,1-4H3 |
| InChIKey | UTPPWBHBIJQTPM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |