C12H16N4O — CID 126851067
4-(5,6,7,8-tetrahydroquinazolin-4-yl)piperazin-2-one (PubChem CID 126851067) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is 4-(5,6,7,8-tetrahydroquinazolin-4-yl)piperazin-2-one.
| Compound Name | 4-(5,6,7,8-tetrahydroquinazolin-4-yl)piperazin-2-one |
|---|---|
| PubChem CID | 126851067 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 4-(5,6,7,8-tetrahydroquinazolin-4-yl)piperazin-2-one |
| SMILES | O=C1CN(c2ncnc3c2CCCC3)CCN1 |
| InChI | InChI=1S/C12H16N4O/c17-11-7-16(6-5-13-11)12-9-3-1-2-4-10(9)14-8-15-12/h8H,1-7H2,(H,13,17) |
| InChIKey | CZWCBPSUVMVMLS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |