C11H14N2O — CID 126853160
2-prop-2-enyl-5,6,7,8-tetrahydrocinnolin-3-one (PubChem CID 126853160) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-prop-2-enyl-5,6,7,8-tetrahydrocinnolin-3-one.
| Compound Name | 2-prop-2-enyl-5,6,7,8-tetrahydrocinnolin-3-one |
|---|---|
| PubChem CID | 126853160 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-prop-2-enyl-5,6,7,8-tetrahydrocinnolin-3-one |
| SMILES | C=CCn1nc2c(cc1=O)CCCC2 |
| InChI | InChI=1S/C11H14N2O/c1-2-7-13-11(14)8-9-5-3-4-6-10(9)12-13/h2,8H,1,3-7H2 |
| InChIKey | XKAALIJGPLCBGY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|