C16H14N6O2 — CID 126854260
1-methyl-6-oxo-N-[(3-pyridin-4-ylpyrazin-2-yl)methyl]pyridazine-3-carboxamide (PubChem CID 126854260) has the molecular formula C16H14N6O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is 1-methyl-6-oxo-N-[(3-pyridin-4-ylpyrazin-2-yl)methyl]pyridazine-3-carboxamide.
| Compound Name | 1-methyl-6-oxo-N-[(3-pyridin-4-ylpyrazin-2-yl)methyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 126854260 |
| Molecular Formula | C16H14N6O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1-methyl-6-oxo-N-[(3-pyridin-4-ylpyrazin-2-yl)methyl]pyridazine-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCc2nccnc2-c2ccncc2)ccc1=O |
| InChI | InChI=1S/C16H14N6O2/c1-22-14(23)3-2-12(21-22)16(24)20-10-13-15(19-9-8-18-13)11-4-6-17-7-5-11/h2-9H,10H2,1H3,(H,20,24) |
| InChIKey | VMMIIQBBHREQKT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |