C17H15FN4O3S — CID 126854274
5-fluoro-2-methoxy-N-[(3-pyridin-4-ylpyrazin-2-yl)methyl]benzenesulfonamide (PubChem CID 126854274) has the molecular formula C17H15FN4O3S and a molecular weight of 374.40 g/mol. Its IUPAC name is 5-fluoro-2-methoxy-N-[(3-pyridin-4-ylpyrazin-2-yl)methyl]benzenesulfonamide.
| Compound Name | 5-fluoro-2-methoxy-N-[(3-pyridin-4-ylpyrazin-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 126854274 |
| Molecular Formula | C17H15FN4O3S |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 5-fluoro-2-methoxy-N-[(3-pyridin-4-ylpyrazin-2-yl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(F)cc1S(=O)(=O)NCc1nccnc1-c1ccncc1 |
| InChI | InChI=1S/C17H15FN4O3S/c1-25-15-3-2-13(18)10-16(15)26(23,24)22-11-14-17(21-9-8-20-14)12-4-6-19-7-5-12/h2-10,22H,11H2,1H3 |
| InChIKey | PMNGIJGETORXAX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |