C16H22F3N3O5 — CID 126854968
ethyl 4-[4-[2,4-dioxo-3-(2,2,2-trifluoroethyl)imidazolidin-1-yl]piperidin-1-yl]-4-oxobutanoate (PubChem CID 126854968) has the molecular formula C16H22F3N3O5 and a molecular weight of 393.36 g/mol. Its IUPAC name is ethyl 4-[4-[2,4-dioxo-3-(2,2,2-trifluoroethyl)imidazolidin-1-yl]piperidin-1-yl]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-[2,4-dioxo-3-(2,2,2-trifluoroethyl)imidazolidin-1-yl]piperidin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 126854968 |
| Molecular Formula | C16H22F3N3O5 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | ethyl 4-[4-[2,4-dioxo-3-(2,2,2-trifluoroethyl)imidazolidin-1-yl]piperidin-1-yl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N1CCC(N2CC(=O)N(CC(F)(F)F)C2=O)CC1 |
| InChI | InChI=1S/C16H22F3N3O5/c1-2-27-14(25)4-3-12(23)20-7-5-11(6-8-20)21-9-13(24)22(15(21)26)10-16(17,18)19/h11H,2-10H2,1H3 |
| InChIKey | YODROQUQQGSNFN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|