C20H23N7O2 — CID 126855869
6-methyl-2-[2-[4-(2-phenyltriazole-4-carbonyl)piperazin-1-yl]ethyl]pyridazin-3-one (PubChem CID 126855869) has the molecular formula C20H23N7O2 and a molecular weight of 393.45 g/mol. Its IUPAC name is 6-methyl-2-[2-[4-(2-phenyltriazole-4-carbonyl)piperazin-1-yl]ethyl]pyridazin-3-one.
| Compound Name | 6-methyl-2-[2-[4-(2-phenyltriazole-4-carbonyl)piperazin-1-yl]ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 126855869 |
| Molecular Formula | C20H23N7O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 6-methyl-2-[2-[4-(2-phenyltriazole-4-carbonyl)piperazin-1-yl]ethyl]pyridazin-3-one |
| SMILES | Cc1ccc(=O)n(CCN2CCN(C(=O)c3cnn(-c4ccccc4)n3)CC2)n1 |
| InChI | InChI=1S/C20H23N7O2/c1-16-7-8-19(28)26(22-16)14-11-24-9-12-25(13-10-24)20(29)18-15-21-27(23-18)17-5-3-2-4-6-17/h2-8,15H,9-14H2,1H3 |
| InChIKey | KJNBCZWUNJWTKK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 89.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |