About [4-[(1R,2R)-2-fluorocyclopentyl]piperazin-1-yl]-(5-methyl-1,2-oxazol-4-yl)methanone
[4-[(1R,2R)-2-fluorocyclopentyl]piperazin-1-yl]-(5-methyl-1,2-oxazol-4-yl)methanone (PubChem CID 126856276) has the molecular formula C14H20FN3O2
and a molecular weight of 281.33 g/mol. Its IUPAC name is [4-[(1R,2R)-2-fluorocyclopentyl]piperazin-1-yl]-(5-methyl-1,2-oxazol-4-yl)methanone.
Molecular Properties
| Compound Name | [4-[(1R,2R)-2-fluorocyclopentyl]piperazin-1-yl]-(5-methyl-1,2-oxazol-4-yl)methanone |
| PubChem CID | 126856276 |
| Molecular Formula | C14H20FN3O2 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | [4-[(1R,2R)-2-fluorocyclopentyl]piperazin-1-yl]-(5-methyl-1,2-oxazol-4-yl)methanone |
| SMILES | Cc1oncc1C(=O)N1CCN([C@@H]2CCC[C@H]2F)CC1 |
| InChI | InChI=1S/C14H20FN3O2/c1-10-11(9-16-20-10)14(19)18-7-5-17(6-8-18)13-4-2-3-12(13)15/h9,12-13H,2-8H2,1H3/t12-,13-/m1/s1 |
| InChIKey | DVSRKNZSYPNERP-CHWSQXEVSA-N |
| XLogP | 1.63 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(1R,2R)-2-fluorocyclopentyl]piperazin-1-yl]-(5-methyl-1,2-oxazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(1R,2R)-2-fluorocyclopentyl]piperazin-1-yl]-(5-methyl-1,2-oxazol-4-yl)methanone?
The IUPAC name of [4-[(1R,2R)-2-fluorocyclopentyl]piperazin-1-yl]-(5-methyl-1,2-oxazol-4-yl)methanone (CID 126856276) is [4-[(1R,2R)-2-fluorocyclopentyl]piperazin-1-yl]-(5-methyl-1,2-oxazol-4-yl)methanone.
What is the SMILES notation for [4-[(1R,2R)-2-fluorocyclopentyl]piperazin-1-yl]-(5-methyl-1,2-oxazol-4-yl)methanone?
The canonical SMILES for [4-[(1R,2R)-2-fluorocyclopentyl]piperazin-1-yl]-(5-methyl-1,2-oxazol-4-yl)methanone is Cc1oncc1C(=O)N1CCN([C@@H]2CCC[C@H]2F)CC1.
What is the InChIKey of [4-[(1R,2R)-2-fluorocyclopentyl]piperazin-1-yl]-(5-methyl-1,2-oxazol-4-yl)methanone?
The InChIKey is DVSRKNZSYPNERP-CHWSQXEVSA-N. The full InChI is InChI=1S/C14H20FN3O2/c1-10-11(9-16-20-10)14(19)18-7-5-17(6-8-18)13-4-2-3-12(13)15/h9,12-13H,2-8H2,1H3/t12-,13-/m1/s1.
What are the key properties of [4-[(1R,2R)-2-fluorocyclopentyl]piperazin-1-yl]-(5-methyl-1,2-oxazol-4-yl)methanone?
[4-[(1R,2R)-2-fluorocyclopentyl]piperazin-1-yl]-(5-methyl-1,2-oxazol-4-yl)methanone has a molecular weight of 281.33 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(1R,2R)-2-fluorocyclopentyl]piperazin-1-yl]-(5-methyl-1,2-oxazol-4-yl)methanone is sourced from PubChem (CID 126856276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).