C11H16FN3O2 — CID 126857055
N-(2-fluorooxan-3-yl)-2,5-dimethylpyrazole-3-carboxamide (PubChem CID 126857055) has the molecular formula C11H16FN3O2 and a molecular weight of 241.27 g/mol. Its IUPAC name is N-(2-fluorooxan-3-yl)-2,5-dimethylpyrazole-3-carboxamide.
| Compound Name | N-(2-fluorooxan-3-yl)-2,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 126857055 |
| Molecular Formula | C11H16FN3O2 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N-(2-fluorooxan-3-yl)-2,5-dimethylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCCOC2F)n(C)n1 |
| InChI | InChI=1S/C11H16FN3O2/c1-7-6-9(15(2)14-7)11(16)13-8-4-3-5-17-10(8)12/h6,8,10H,3-5H2,1-2H3,(H,13,16) |
| InChIKey | HVYVVJLLMXFMLP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |