About 6-methyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one
6-methyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one (PubChem CID 126857542) has the molecular formula C7H7F3N2O
and a molecular weight of 192.14 g/mol. Its IUPAC name is 6-methyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one.
Molecular Properties
| Compound Name | 6-methyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one |
| PubChem CID | 126857542 |
| Molecular Formula | C7H7F3N2O |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 6-methyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one |
| SMILES | Cc1cc(=O)n(CC(F)(F)F)cn1 |
| InChI | InChI=1S/C7H7F3N2O/c1-5-2-6(13)12(4-11-5)3-7(8,9)10/h2,4H,3H2,1H3 |
| InChIKey | PAUQUQAKURABHB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one?
The IUPAC name of 6-methyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one (CID 126857542) is 6-methyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one.
What is the SMILES notation for 6-methyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one?
The canonical SMILES for 6-methyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one is Cc1cc(=O)n(CC(F)(F)F)cn1.
What is the InChIKey of 6-methyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one?
The InChIKey is PAUQUQAKURABHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3N2O/c1-5-2-6(13)12(4-11-5)3-7(8,9)10/h2,4H,3H2,1H3.
What are the key properties of 6-methyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one?
6-methyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one has a molecular weight of 192.14 g/mol, XLogP of 1.11, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one is sourced from PubChem (CID 126857542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).