About 3-cyclopentyl-5,6-dimethylpyrimidin-4-one
3-cyclopentyl-5,6-dimethylpyrimidin-4-one (PubChem CID 126857571) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-cyclopentyl-5,6-dimethylpyrimidin-4-one.
Molecular Properties
| Compound Name | 3-cyclopentyl-5,6-dimethylpyrimidin-4-one |
| PubChem CID | 126857571 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 3-cyclopentyl-5,6-dimethylpyrimidin-4-one |
| SMILES | Cc1ncn(C2CCCC2)c(=O)c1C |
| InChI | InChI=1S/C11H16N2O/c1-8-9(2)12-7-13(11(8)14)10-5-3-4-6-10/h7,10H,3-6H2,1-2H3 |
| InChIKey | XFCOLFADTXNKHP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclopentyl-5,6-dimethylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-5,6-dimethylpyrimidin-4-one?
The IUPAC name of 3-cyclopentyl-5,6-dimethylpyrimidin-4-one (CID 126857571) is 3-cyclopentyl-5,6-dimethylpyrimidin-4-one.
What is the SMILES notation for 3-cyclopentyl-5,6-dimethylpyrimidin-4-one?
The canonical SMILES for 3-cyclopentyl-5,6-dimethylpyrimidin-4-one is Cc1ncn(C2CCCC2)c(=O)c1C.
What is the InChIKey of 3-cyclopentyl-5,6-dimethylpyrimidin-4-one?
The InChIKey is XFCOLFADTXNKHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O/c1-8-9(2)12-7-13(11(8)14)10-5-3-4-6-10/h7,10H,3-6H2,1-2H3.
What are the key properties of 3-cyclopentyl-5,6-dimethylpyrimidin-4-one?
3-cyclopentyl-5,6-dimethylpyrimidin-4-one has a molecular weight of 192.26 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-5,6-dimethylpyrimidin-4-one is sourced from PubChem (CID 126857571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).