About 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-one
3-[(2-methyl-1,3-thiazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-one (PubChem CID 126857674) has the molecular formula C10H8F3N3OS
and a molecular weight of 275.26 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-one |
| PubChem CID | 126857674 |
| Molecular Formula | C10H8F3N3OS |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-one |
| SMILES | Cc1nc(Cn2cnc(C(F)(F)F)cc2=O)cs1 |
| InChI | InChI=1S/C10H8F3N3OS/c1-6-15-7(4-18-6)3-16-5-14-8(2-9(16)17)10(11,12)13/h2,4-5H,3H2,1H3 |
| InChIKey | IEEHJPFNKKJPIX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-one?
The IUPAC name of 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-one (CID 126857674) is 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-one.
What is the SMILES notation for 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-one?
The canonical SMILES for 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-one is Cc1nc(Cn2cnc(C(F)(F)F)cc2=O)cs1.
What is the InChIKey of 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-one?
The InChIKey is IEEHJPFNKKJPIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3N3OS/c1-6-15-7(4-18-6)3-16-5-14-8(2-9(16)17)10(11,12)13/h2,4-5H,3H2,1H3.
What are the key properties of 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-one?
3-[(2-methyl-1,3-thiazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-one has a molecular weight of 275.26 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-one is sourced from PubChem (CID 126857674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).