C8H10O3 — CID 12685826
1-methyl-3a,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,4-dione (PubChem CID 12685826) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is 1-methyl-3a,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,4-dione.
| Compound Name | 1-methyl-3a,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,4-dione |
|---|---|
| PubChem CID | 12685826 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 1-methyl-3a,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,4-dione |
| SMILES | CC1OC(=O)C2C(=O)CCC12 |
| InChI | InChI=1S/C8H10O3/c1-4-5-2-3-6(9)7(5)8(10)11-4/h4-5,7H,2-3H2,1H3 |
| InChIKey | KAUOWACGUDPWBT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|