About prop-2-enyl N-methylcarbamate
prop-2-enyl N-methylcarbamate (PubChem CID 12685968) has the molecular formula C5H9NO2
and a molecular weight of 115.13 g/mol. Its IUPAC name is prop-2-enyl N-methylcarbamate.
Molecular Properties
| Compound Name | prop-2-enyl N-methylcarbamate |
| PubChem CID | 12685968 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | prop-2-enyl N-methylcarbamate |
| SMILES | C=CCOC(=O)NC |
| InChI | InChI=1S/C5H9NO2/c1-3-4-8-5(7)6-2/h3H,1,4H2,2H3,(H,6,7) |
| InChIKey | XGEAREWNUGXKQN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl N-methylcarbamate?
The IUPAC name of prop-2-enyl N-methylcarbamate (CID 12685968) is prop-2-enyl N-methylcarbamate.
What is the SMILES notation for prop-2-enyl N-methylcarbamate?
The canonical SMILES for prop-2-enyl N-methylcarbamate is C=CCOC(=O)NC.
What is the InChIKey of prop-2-enyl N-methylcarbamate?
The InChIKey is XGEAREWNUGXKQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2/c1-3-4-8-5(7)6-2/h3H,1,4H2,2H3,(H,6,7).
What are the key properties of prop-2-enyl N-methylcarbamate?
prop-2-enyl N-methylcarbamate has a molecular weight of 115.13 g/mol, XLogP of 0.53, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl N-methylcarbamate is sourced from PubChem (CID 12685968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).