About 6-tert-butyl-2-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one
6-tert-butyl-2-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one (PubChem CID 126862483) has the molecular formula C18H26N4O2
and a molecular weight of 330.43 g/mol. Its IUPAC name is 6-tert-butyl-2-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 6-tert-butyl-2-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one |
| PubChem CID | 126862483 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 6-tert-butyl-2-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one |
| SMILES | CC(C)(C)c1ccc(=O)n(CC2CCN(Cc3cocn3)CC2)n1 |
| InChI | InChI=1S/C18H26N4O2/c1-18(2,3)16-4-5-17(23)22(20-16)10-14-6-8-21(9-7-14)11-15-12-24-13-19-15/h4-5,12-14H,6-11H2,1-3H3 |
| InChIKey | BVEAUTNBJQFECY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-tert-butyl-2-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one?
The IUPAC name of 6-tert-butyl-2-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one (CID 126862483) is 6-tert-butyl-2-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one.
What is the SMILES notation for 6-tert-butyl-2-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one?
The canonical SMILES for 6-tert-butyl-2-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one is CC(C)(C)c1ccc(=O)n(CC2CCN(Cc3cocn3)CC2)n1.
What is the InChIKey of 6-tert-butyl-2-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one?
The InChIKey is BVEAUTNBJQFECY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N4O2/c1-18(2,3)16-4-5-17(23)22(20-16)10-14-6-8-21(9-7-14)11-15-12-24-13-19-15/h4-5,12-14H,6-11H2,1-3H3.
What are the key properties of 6-tert-butyl-2-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one?
6-tert-butyl-2-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one has a molecular weight of 330.43 g/mol, XLogP of 2.44, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one is sourced from PubChem (CID 126862483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).