C20H22N4O2 — CID 126863817
2-[[1-(1H-indole-2-carbonyl)piperidin-4-yl]methyl]-6-methylpyridazin-3-one (PubChem CID 126863817) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-[[1-(1H-indole-2-carbonyl)piperidin-4-yl]methyl]-6-methylpyridazin-3-one.
| Compound Name | 2-[[1-(1H-indole-2-carbonyl)piperidin-4-yl]methyl]-6-methylpyridazin-3-one |
|---|---|
| PubChem CID | 126863817 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-[[1-(1H-indole-2-carbonyl)piperidin-4-yl]methyl]-6-methylpyridazin-3-one |
| SMILES | Cc1ccc(=O)n(CC2CCN(C(=O)c3cc4ccccc4[nH]3)CC2)n1 |
| InChI | InChI=1S/C20H22N4O2/c1-14-6-7-19(25)24(22-14)13-15-8-10-23(11-9-15)20(26)18-12-16-4-2-3-5-17(16)21-18/h2-7,12,15,21H,8-11,13H2,1H3 |
| InChIKey | NPPNHSQSYFSOMD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |