C15H18FN5O — CID 126864188
2-[[1-(5-fluoropyrimidin-4-yl)piperidin-4-yl]methyl]-6-methylpyridazin-3-one (PubChem CID 126864188) has the molecular formula C15H18FN5O and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-[[1-(5-fluoropyrimidin-4-yl)piperidin-4-yl]methyl]-6-methylpyridazin-3-one.
| Compound Name | 2-[[1-(5-fluoropyrimidin-4-yl)piperidin-4-yl]methyl]-6-methylpyridazin-3-one |
|---|---|
| PubChem CID | 126864188 |
| Molecular Formula | C15H18FN5O |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-[[1-(5-fluoropyrimidin-4-yl)piperidin-4-yl]methyl]-6-methylpyridazin-3-one |
| SMILES | Cc1ccc(=O)n(CC2CCN(c3ncncc3F)CC2)n1 |
| InChI | InChI=1S/C15H18FN5O/c1-11-2-3-14(22)21(19-11)9-12-4-6-20(7-5-12)15-13(16)8-17-10-18-15/h2-3,8,10,12H,4-7,9H2,1H3 |
| InChIKey | LPZYJHJRDVTLJP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |