C18H21N7O — CID 126864466
6-pyrazol-1-yl-2-[[1-(pyrimidin-2-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one (PubChem CID 126864466) has the molecular formula C18H21N7O and a molecular weight of 351.41 g/mol. Its IUPAC name is 6-pyrazol-1-yl-2-[[1-(pyrimidin-2-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one.
| Compound Name | 6-pyrazol-1-yl-2-[[1-(pyrimidin-2-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 126864466 |
| Molecular Formula | C18H21N7O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 6-pyrazol-1-yl-2-[[1-(pyrimidin-2-ylmethyl)piperidin-4-yl]methyl]pyridazin-3-one |
| SMILES | O=c1ccc(-n2cccn2)nn1CC1CCN(Cc2ncccn2)CC1 |
| InChI | InChI=1S/C18H21N7O/c26-18-4-3-17(24-10-2-9-21-24)22-25(18)13-15-5-11-23(12-6-15)14-16-19-7-1-8-20-16/h1-4,7-10,15H,5-6,11-14H2 |
| InChIKey | TXGOVCBNJCXVSP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |