About N-ethyl-3,4-dimethoxyaniline
N-ethyl-3,4-dimethoxyaniline (PubChem CID 12686507) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is N-ethyl-3,4-dimethoxyaniline.
Molecular Properties
| Compound Name | N-ethyl-3,4-dimethoxyaniline |
| PubChem CID | 12686507 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N-ethyl-3,4-dimethoxyaniline |
| SMILES | CCNc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C10H15NO2/c1-4-11-8-5-6-9(12-2)10(7-8)13-3/h5-7,11H,4H2,1-3H3 |
| InChIKey | PEQJBOMPGWYIRO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3,4-dimethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3,4-dimethoxyaniline?
The IUPAC name of N-ethyl-3,4-dimethoxyaniline (CID 12686507) is N-ethyl-3,4-dimethoxyaniline.
What is the SMILES notation for N-ethyl-3,4-dimethoxyaniline?
The canonical SMILES for N-ethyl-3,4-dimethoxyaniline is CCNc1ccc(OC)c(OC)c1.
What is the InChIKey of N-ethyl-3,4-dimethoxyaniline?
The InChIKey is PEQJBOMPGWYIRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-4-11-8-5-6-9(12-2)10(7-8)13-3/h5-7,11H,4H2,1-3H3.
What are the key properties of N-ethyl-3,4-dimethoxyaniline?
N-ethyl-3,4-dimethoxyaniline has a molecular weight of 181.23 g/mol, XLogP of 2.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3,4-dimethoxyaniline is sourced from PubChem (CID 12686507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).