About 7,8-diethyl-4,5-dihydro-1H-benzo[g]indazole
7,8-diethyl-4,5-dihydro-1H-benzo[g]indazole (PubChem CID 12686517) has the molecular formula C15H18N2
and a molecular weight of 226.32 g/mol. Its IUPAC name is 7,8-diethyl-4,5-dihydro-1H-benzo[g]indazole.
Molecular Properties
| Compound Name | 7,8-diethyl-4,5-dihydro-1H-benzo[g]indazole |
| PubChem CID | 12686517 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 7,8-diethyl-4,5-dihydro-1H-benzo[g]indazole |
| SMILES | CCc1cc2c(cc1CC)-c1[nH]ncc1CC2 |
| InChI | InChI=1S/C15H18N2/c1-3-10-7-12-5-6-13-9-16-17-15(13)14(12)8-11(10)4-2/h7-9H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | RFTYQGPFGOCWPI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7,8-diethyl-4,5-dihydro-1H-benzo[g]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-diethyl-4,5-dihydro-1H-benzo[g]indazole?
The IUPAC name of 7,8-diethyl-4,5-dihydro-1H-benzo[g]indazole (CID 12686517) is 7,8-diethyl-4,5-dihydro-1H-benzo[g]indazole.
What is the SMILES notation for 7,8-diethyl-4,5-dihydro-1H-benzo[g]indazole?
The canonical SMILES for 7,8-diethyl-4,5-dihydro-1H-benzo[g]indazole is CCc1cc2c(cc1CC)-c1[nH]ncc1CC2.
What is the InChIKey of 7,8-diethyl-4,5-dihydro-1H-benzo[g]indazole?
The InChIKey is RFTYQGPFGOCWPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2/c1-3-10-7-12-5-6-13-9-16-17-15(13)14(12)8-11(10)4-2/h7-9H,3-6H2,1-2H3,(H,16,17).
What are the key properties of 7,8-diethyl-4,5-dihydro-1H-benzo[g]indazole?
7,8-diethyl-4,5-dihydro-1H-benzo[g]indazole has a molecular weight of 226.32 g/mol, XLogP of 3.30, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-diethyl-4,5-dihydro-1H-benzo[g]indazole is sourced from PubChem (CID 12686517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).