About 1,4-dihydrothiochromeno[3,4-d]pyrazole
1,4-dihydrothiochromeno[3,4-d]pyrazole (PubChem CID 12686522) has the molecular formula C10H8N2S
and a molecular weight of 188.26 g/mol. Its IUPAC name is 1,4-dihydrothiochromeno[3,4-d]pyrazole.
Molecular Properties
| Compound Name | 1,4-dihydrothiochromeno[3,4-d]pyrazole |
| PubChem CID | 12686522 |
| Molecular Formula | C10H8N2S |
| Molecular Weight | 188.26 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 1,4-dihydrothiochromeno[3,4-d]pyrazole |
| SMILES | c1ccc2c(c1)SCc1cn[nH]c1-2 |
| InChI | InChI=1S/C10H8N2S/c1-2-4-9-8(3-1)10-7(6-13-9)5-11-12-10/h1-5H,6H2,(H,11,12) |
| InChIKey | TVPJODVFKPLXPS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dihydrothiochromeno[3,4-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydrothiochromeno[3,4-d]pyrazole?
The IUPAC name of 1,4-dihydrothiochromeno[3,4-d]pyrazole (CID 12686522) is 1,4-dihydrothiochromeno[3,4-d]pyrazole.
What is the SMILES notation for 1,4-dihydrothiochromeno[3,4-d]pyrazole?
The canonical SMILES for 1,4-dihydrothiochromeno[3,4-d]pyrazole is c1ccc2c(c1)SCc1cn[nH]c1-2.
What is the InChIKey of 1,4-dihydrothiochromeno[3,4-d]pyrazole?
The InChIKey is TVPJODVFKPLXPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2S/c1-2-4-9-8(3-1)10-7(6-13-9)5-11-12-10/h1-5H,6H2,(H,11,12).
What are the key properties of 1,4-dihydrothiochromeno[3,4-d]pyrazole?
1,4-dihydrothiochromeno[3,4-d]pyrazole has a molecular weight of 188.26 g/mol, XLogP of 2.68, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydrothiochromeno[3,4-d]pyrazole is sourced from PubChem (CID 12686522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).