About 4-bromo-2-phenyltriazole
4-bromo-2-phenyltriazole (PubChem CID 12686659) has the molecular formula C8H6BrN3
and a molecular weight of 224.06 g/mol. Its IUPAC name is 4-bromo-2-phenyltriazole.
Molecular Properties
| Compound Name | 4-bromo-2-phenyltriazole |
| PubChem CID | 12686659 |
| Molecular Formula | C8H6BrN3 |
| Molecular Weight | 224.06 g/mol |
| Exact Mass | 222.97 |
| IUPAC Name | 4-bromo-2-phenyltriazole |
| SMILES | Brc1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C8H6BrN3/c9-8-6-10-12(11-8)7-4-2-1-3-5-7/h1-6H |
| InChIKey | OOZQRQYBKXHSPT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.06 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-2-phenyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-phenyltriazole?
The IUPAC name of 4-bromo-2-phenyltriazole (CID 12686659) is 4-bromo-2-phenyltriazole.
What is the SMILES notation for 4-bromo-2-phenyltriazole?
The canonical SMILES for 4-bromo-2-phenyltriazole is Brc1cnn(-c2ccccc2)n1.
What is the InChIKey of 4-bromo-2-phenyltriazole?
The InChIKey is OOZQRQYBKXHSPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrN3/c9-8-6-10-12(11-8)7-4-2-1-3-5-7/h1-6H.
What are the key properties of 4-bromo-2-phenyltriazole?
4-bromo-2-phenyltriazole has a molecular weight of 224.06 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-phenyltriazole is sourced from PubChem (CID 12686659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).