C10H11F10NO — CID 12686759
N,N-diethyl-3,3,4,4,5,5,5-heptafluoro-2-(trifluoromethyl)pentanamide (PubChem CID 12686759) has the molecular formula C10H11F10NO and a molecular weight of 351.18 g/mol. Its IUPAC name is N,N-diethyl-3,3,4,4,5,5,5-heptafluoro-2-(trifluoromethyl)pentanamide.
| Compound Name | N,N-diethyl-3,3,4,4,5,5,5-heptafluoro-2-(trifluoromethyl)pentanamide |
|---|---|
| PubChem CID | 12686759 |
| Molecular Formula | C10H11F10NO |
| Molecular Weight | 351.18 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N,N-diethyl-3,3,4,4,5,5,5-heptafluoro-2-(trifluoromethyl)pentanamide |
| SMILES | CCN(CC)C(=O)C(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11F10NO/c1-3-21(4-2)6(22)5(8(13,14)15)7(11,12)9(16,17)10(18,19)20/h5H,3-4H2,1-2H3 |
| InChIKey | GUSDWERHHUHOTK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.18 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|