C11H10F11N — CID 12686761
1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]piperidine (PubChem CID 12686761) has the molecular formula C11H10F11N and a molecular weight of 365.19 g/mol. Its IUPAC name is 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]piperidine.
| Compound Name | 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]piperidine |
|---|---|
| PubChem CID | 12686761 |
| Molecular Formula | C11H10F11N |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]piperidine |
| SMILES | FC(F)(F)C(=C(N1CCCCC1)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H10F11N/c12-8(13,11(20,21)22)7(23-4-2-1-3-5-23)6(9(14,15)16)10(17,18)19/h1-5H2 |
| InChIKey | GAIDVYPHYKLTNI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|