About [(E)-2-(benzhydrylideneamino)-1,2-diphenylethenyl] benzoate
[(E)-2-(benzhydrylideneamino)-1,2-diphenylethenyl] benzoate (PubChem CID 12687432) has the molecular formula C34H25NO2
and a molecular weight of 479.58 g/mol. Its IUPAC name is [(E)-2-(benzhydrylideneamino)-1,2-diphenylethenyl] benzoate.
Molecular Properties
| Compound Name | [(E)-2-(benzhydrylideneamino)-1,2-diphenylethenyl] benzoate |
| PubChem CID | 12687432 |
| Molecular Formula | C34H25NO2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | [(E)-2-(benzhydrylideneamino)-1,2-diphenylethenyl] benzoate |
| SMILES | O=C(O/C(=C(/N=C(c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H25NO2/c36-34(30-24-14-5-15-25-30)37-33(29-22-12-4-13-23-29)32(28-20-10-3-11-21-28)35-31(26-16-6-1-7-17-26)27-18-8-2-9-19-27/h1-25H/b33-32+ |
| InChIKey | HNIUEPFMMHSSHB-ULIFNZDWSA-N |
| XLogP | 7.91 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2-(benzhydrylideneamino)-1,2-diphenylethenyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-(benzhydrylideneamino)-1,2-diphenylethenyl] benzoate?
The IUPAC name of [(E)-2-(benzhydrylideneamino)-1,2-diphenylethenyl] benzoate (CID 12687432) is [(E)-2-(benzhydrylideneamino)-1,2-diphenylethenyl] benzoate.
What is the SMILES notation for [(E)-2-(benzhydrylideneamino)-1,2-diphenylethenyl] benzoate?
The canonical SMILES for [(E)-2-(benzhydrylideneamino)-1,2-diphenylethenyl] benzoate is O=C(O/C(=C(/N=C(c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of [(E)-2-(benzhydrylideneamino)-1,2-diphenylethenyl] benzoate?
The InChIKey is HNIUEPFMMHSSHB-ULIFNZDWSA-N. The full InChI is InChI=1S/C34H25NO2/c36-34(30-24-14-5-15-25-30)37-33(29-22-12-4-13-23-29)32(28-20-10-3-11-21-28)35-31(26-16-6-1-7-17-26)27-18-8-2-9-19-27/h1-25H/b33-32+.
What are the key properties of [(E)-2-(benzhydrylideneamino)-1,2-diphenylethenyl] benzoate?
[(E)-2-(benzhydrylideneamino)-1,2-diphenylethenyl] benzoate has a molecular weight of 479.58 g/mol, XLogP of 7.91, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-(benzhydrylideneamino)-1,2-diphenylethenyl] benzoate is sourced from PubChem (CID 12687432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).