About 3,4-dimethylhexa-1,5-diyne
3,4-dimethylhexa-1,5-diyne (PubChem CID 12687479) has the molecular formula C8H10
and a molecular weight of 106.17 g/mol. Its IUPAC name is 3,4-dimethylhexa-1,5-diyne.
Molecular Properties
| Compound Name | 3,4-dimethylhexa-1,5-diyne |
| PubChem CID | 12687479 |
| Molecular Formula | C8H10 |
| Molecular Weight | 106.17 g/mol |
| Exact Mass | 106.08 |
| IUPAC Name | 3,4-dimethylhexa-1,5-diyne |
| SMILES | C#CC(C)C(C)C#C |
| InChI | InChI=1S/C8H10/c1-5-7(3)8(4)6-2/h1-2,7-8H,3-4H3 |
| InChIKey | OCZFEHQJSQDCTK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.17 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethylhexa-1,5-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylhexa-1,5-diyne?
The IUPAC name of 3,4-dimethylhexa-1,5-diyne (CID 12687479) is 3,4-dimethylhexa-1,5-diyne.
What is the SMILES notation for 3,4-dimethylhexa-1,5-diyne?
The canonical SMILES for 3,4-dimethylhexa-1,5-diyne is C#CC(C)C(C)C#C.
What is the InChIKey of 3,4-dimethylhexa-1,5-diyne?
The InChIKey is OCZFEHQJSQDCTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10/c1-5-7(3)8(4)6-2/h1-2,7-8H,3-4H3.
What are the key properties of 3,4-dimethylhexa-1,5-diyne?
3,4-dimethylhexa-1,5-diyne has a molecular weight of 106.17 g/mol, XLogP of 1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylhexa-1,5-diyne is sourced from PubChem (CID 12687479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).