C7H10Cl4S — CID 12687904
3-methyl-1-(1,2,2,2-tetrachloroethylsulfanyl)but-2-ene (PubChem CID 12687904) has the molecular formula C7H10Cl4S and a molecular weight of 268.04 g/mol. Its IUPAC name is 3-methyl-1-(1,2,2,2-tetrachloroethylsulfanyl)but-2-ene.
| Compound Name | 3-methyl-1-(1,2,2,2-tetrachloroethylsulfanyl)but-2-ene |
|---|---|
| PubChem CID | 12687904 |
| Molecular Formula | C7H10Cl4S |
| Molecular Weight | 268.04 g/mol |
| Exact Mass | 265.93 |
| IUPAC Name | 3-methyl-1-(1,2,2,2-tetrachloroethylsulfanyl)but-2-ene |
| SMILES | CC(C)=CCSC(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H10Cl4S/c1-5(2)3-4-12-6(8)7(9,10)11/h3,6H,4H2,1-2H3 |
| InChIKey | XOSCDKMXFDJEBD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.04 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|