C11H10Cl4S — CID 12687905
[(E)-3-(1,2,2,2-tetrachloroethylsulfanyl)prop-1-enyl]benzene (PubChem CID 12687905) has the molecular formula C11H10Cl4S and a molecular weight of 316.08 g/mol. Its IUPAC name is [(E)-3-(1,2,2,2-tetrachloroethylsulfanyl)prop-1-enyl]benzene.
| Compound Name | [(E)-3-(1,2,2,2-tetrachloroethylsulfanyl)prop-1-enyl]benzene |
|---|---|
| PubChem CID | 12687905 |
| Molecular Formula | C11H10Cl4S |
| Molecular Weight | 316.08 g/mol |
| Exact Mass | 313.93 |
| IUPAC Name | [(E)-3-(1,2,2,2-tetrachloroethylsulfanyl)prop-1-enyl]benzene |
| SMILES | ClC(SC/C=C/c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H10Cl4S/c12-10(11(13,14)15)16-8-4-7-9-5-2-1-3-6-9/h1-7,10H,8H2/b7-4+ |
| InChIKey | ODZCEGYWVFAPLZ-QPJJXVBHSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.08 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|